C32H35N3O8 — CID 91012623
(4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[4-(pent-4-enoylamino)phenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 91012623) has the molecular formula C32H35N3O8 and a molecular weight of 589.65 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[4-(pent-4-enoylamino)phenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[4-(pent-4-enoylamino)phenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91012623 |
| Molecular Formula | C32H35N3O8 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[4-(pent-4-enoylamino)phenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | C=CCCC(=O)Nc1ccc(-c2ccc(O)c3c2C[C@@H]2C[C@@H]4[C@@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@]4(O)C(=O)C2C3=O)cc1 |
| InChI | InChI=1S/C32H35N3O8/c1-4-5-6-22(37)34-17-9-7-15(8-10-17)18-11-12-21(36)24-19(18)13-16-14-20-26(35(2)3)28(39)25(31(33)42)30(41)32(20,43)29(40)23(16)27(24)38/h4,7-12,16,20,23,25-26,28,36,39,43H,1,5-6,13-14H2,2-3H3,(H2,33,42)(H,34,37)/t16-,20-,23?,25?,26-,28?,32-/m1/s1 |
| InChIKey | LVWHLPCJZRVIQL-IZNRLFMHSA-N |
| XLogP | 1.23 |
| TPSA | 187.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|