C25H30N2O8 — CID 91127519
(4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-7-(1-methoxyprop-1-en-2-yl)-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 91127519) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-7-(1-methoxyprop-1-en-2-yl)-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-7-(1-methoxyprop-1-en-2-yl)-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91127519 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-7-(1-methoxyprop-1-en-2-yl)-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | COC=C(C)c1ccc(O)c2c1C[C@@H]1C[C@@H]3[C@@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C25H30N2O8/c1-10(9-35-4)12-5-6-15(28)17-13(12)7-11-8-14-19(27(2)3)21(30)18(24(26)33)23(32)25(14,34)22(31)16(11)20(17)29/h5-6,9,11,14,16,18-19,21,28,30,34H,7-8H2,1-4H3,(H2,26,33)/t11-,14-,16?,18?,19-,21?,25-/m1/s1 |
| InChIKey | QXYPFOBQGJBXPO-GQZXUASJSA-N |
| XLogP | -0.33 |
| TPSA | 167.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|