C31H35N5O7 — CID 91510348
(4R,4aR,5aS,12aR)-9-[(4-cyanophenyl)methylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 91510348) has the molecular formula C31H35N5O7 and a molecular weight of 589.65 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-9-[(4-cyanophenyl)methylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-9-[(4-cyanophenyl)methylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91510348 |
| Molecular Formula | C31H35N5O7 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | (4R,4aR,5aS,12aR)-9-[(4-cyanophenyl)methylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NCc2ccc(C#N)cc2)c(O)c2c1C[C@@H]1C[C@@H]3[C@@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C31H35N5O7/c1-35(2)20-11-19(34-13-15-7-5-14(12-32)6-8-15)25(37)22-17(20)9-16-10-18-24(36(3)4)27(39)23(30(33)42)29(41)31(18,43)28(40)21(16)26(22)38/h5-8,11,16,18,21,23-24,27,34,37,39,43H,9-10,13H2,1-4H3,(H2,33,42)/t16-,18-,21?,23?,24-,27?,31-/m1/s1 |
| InChIKey | JIDJCDBGHVNVNQ-QIZHTKLMSA-N |
| XLogP | 0.21 |
| TPSA | 197.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|