C29H29F2N3O8 — CID 91427755
(4aS,5aR,12aS)-9-[[4-(difluoromethoxy)phenyl]methylamino]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91427755) has the molecular formula C29H29F2N3O8 and a molecular weight of 585.56 g/mol. Its IUPAC name is (4aS,5aR,12aS)-9-[[4-(difluoromethoxy)phenyl]methylamino]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-9-[[4-(difluoromethoxy)phenyl]methylamino]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91427755 |
| Molecular Formula | C29H29F2N3O8 |
| Molecular Weight | 585.56 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | (4aS,5aR,12aS)-9-[[4-(difluoromethoxy)phenyl]methylamino]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NCc2ccc(OC(F)F)cc2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C29H29F2N3O8/c1-34(2)18-10-17(33-11-12-3-5-15(6-4-12)42-28(30)31)23(36)21-16(18)8-13-7-14-9-19(35)22(27(32)40)26(39)29(14,41)25(38)20(13)24(21)37/h3-6,10,13-14,20,22,28,33,36,41H,7-9,11H2,1-2H3,(H2,32,40)/t13-,14+,20?,22?,29+/m1/s1 |
| InChIKey | UKZXFWPOFZJYFV-ULNFGEMKSA-N |
| XLogP | 1.61 |
| TPSA | 176.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.56 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|