C29H30N2O7 — CID 91558936
(4aS,5aR,12aS)-9-[2-(cyclohexen-1-yl)ethynyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91558936) has the molecular formula C29H30N2O7 and a molecular weight of 518.57 g/mol. Its IUPAC name is (4aS,5aR,12aS)-9-[2-(cyclohexen-1-yl)ethynyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-9-[2-(cyclohexen-1-yl)ethynyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91558936 |
| Molecular Formula | C29H30N2O7 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | (4aS,5aR,12aS)-9-[2-(cyclohexen-1-yl)ethynyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(C#CC2=CCCCC2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C29H30N2O7/c1-31(2)19-12-15(9-8-14-6-4-3-5-7-14)24(33)22-18(19)11-16-10-17-13-20(32)23(28(30)37)27(36)29(17,38)26(35)21(16)25(22)34/h6,12,16-17,21,23,33,38H,3-5,7,10-11,13H2,1-2H3,(H2,30,37)/t16-,17+,21?,23?,29+/m1/s1 |
| InChIKey | QTDQVZLNKKITRU-KJCYYKFZSA-N |
| XLogP | 1.24 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|