C24H27N3O8 — CID 91140284
(4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-9-[1-(methoxyamino)ethenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91140284) has the molecular formula C24H27N3O8 and a molecular weight of 485.49 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-9-[1-(methoxyamino)ethenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-9-[1-(methoxyamino)ethenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91140284 |
| Molecular Formula | C24H27N3O8 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | (4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-9-[1-(methoxyamino)ethenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C=C(NOC)c1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C24H27N3O8/c1-9(26-35-4)12-8-14(27(2)3)13-6-10-5-11-7-15(28)18(23(25)33)22(32)24(11,34)21(31)16(10)20(30)17(13)19(12)29/h8,10-11,16,18,26,29,34H,1,5-7H2,2-4H3,(H2,25,33)/t10-,11+,16?,18?,24+/m1/s1 |
| InChIKey | ZQFDAQYKWUKOSG-HFVQDXCYSA-N |
| XLogP | -0.49 |
| TPSA | 176.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|