C26H30N4O8 — CID 90981530
(4aS,5aR,12aS)-9-[[(1-aminocyclopropanecarbonyl)amino]methyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90981530) has the molecular formula C26H30N4O8 and a molecular weight of 526.55 g/mol. Its IUPAC name is (4aS,5aR,12aS)-9-[[(1-aminocyclopropanecarbonyl)amino]methyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-9-[[(1-aminocyclopropanecarbonyl)amino]methyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90981530 |
| Molecular Formula | C26H30N4O8 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (4aS,5aR,12aS)-9-[[(1-aminocyclopropanecarbonyl)amino]methyl]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CNC(=O)C2(N)CC2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C26H30N4O8/c1-30(2)14-7-11(9-29-24(37)25(28)3-4-25)19(32)17-13(14)6-10-5-12-8-15(31)18(23(27)36)22(35)26(12,38)21(34)16(10)20(17)33/h7,10,12,16,18,32,38H,3-6,8-9,28H2,1-2H3,(H2,27,36)(H,29,37)/t10-,12+,16?,18?,26+/m1/s1 |
| InChIKey | SWSKNWLOYWLFGH-GKOCTBAWSA-N |
| XLogP | -1.50 |
| TPSA | 210.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|