C24H27N3O8S — CID 91295705
S-ethyl N-[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamothioate (PubChem CID 91295705) has the molecular formula C24H27N3O8S and a molecular weight of 517.56 g/mol. Its IUPAC name is S-ethyl N-[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamothioate.
| Compound Name | S-ethyl N-[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamothioate |
|---|---|
| PubChem CID | 91295705 |
| Molecular Formula | C24H27N3O8S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | S-ethyl N-[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamothioate |
| SMILES | CCSC(=O)Nc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C24H27N3O8S/c1-4-36-23(34)26-12-8-13(27(2)3)11-6-9-5-10-7-14(28)17(22(25)33)21(32)24(10,35)20(31)15(9)19(30)16(11)18(12)29/h8-10,15,17,29,35H,4-7H2,1-3H3,(H2,25,33)(H,26,34)/t9-,10+,15?,17?,24+/m1/s1 |
| InChIKey | KADLWRVBIJKOKJ-LRWRHERASA-N |
| XLogP | 0.68 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|