C32H35ClN4O8 — CID 91266447
(4aS,5aR,12aS)-9-[(2-tert-butyl-4-chlorophenyl)carbamoylamino]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91266447) has the molecular formula C32H35ClN4O8 and a molecular weight of 639.11 g/mol. Its IUPAC name is (4aS,5aR,12aS)-9-[(2-tert-butyl-4-chlorophenyl)carbamoylamino]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-9-[(2-tert-butyl-4-chlorophenyl)carbamoylamino]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91266447 |
| Molecular Formula | C32H35ClN4O8 |
| Molecular Weight | 639.11 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | (4aS,5aR,12aS)-9-[(2-tert-butyl-4-chlorophenyl)carbamoylamino]-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)Nc2ccc(Cl)cc2C(C)(C)C)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C32H35ClN4O8/c1-31(2,3)17-11-15(33)6-7-18(17)35-30(44)36-19-12-20(37(4)5)16-9-13-8-14-10-21(38)24(29(34)43)28(42)32(14,45)27(41)22(13)26(40)23(16)25(19)39/h6-7,11-14,22,24,39,45H,8-10H2,1-5H3,(H2,34,43)(H2,35,36,44)/t13-,14+,22?,24?,32+/m1/s1 |
| InChIKey | FVTDWQPFWHDNQK-PLSSWBOOSA-N |
| XLogP | 2.99 |
| TPSA | 196.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|