C27H33N3O9 — CID 91083105
propan-2-yl 2-[[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methylamino]acetate (PubChem CID 91083105) has the molecular formula C27H33N3O9 and a molecular weight of 543.57 g/mol. Its IUPAC name is propan-2-yl 2-[[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methylamino]acetate.
| Compound Name | propan-2-yl 2-[[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methylamino]acetate |
|---|---|
| PubChem CID | 91083105 |
| Molecular Formula | C27H33N3O9 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | propan-2-yl 2-[[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methylamino]acetate |
| SMILES | CC(C)OC(=O)CNCc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C27H33N3O9/c1-11(2)39-18(32)10-29-9-13-7-16(30(3)4)15-6-12-5-14-8-17(31)21(26(28)37)25(36)27(14,38)24(35)19(12)23(34)20(15)22(13)33/h7,11-12,14,19,21,29,33,38H,5-6,8-10H2,1-4H3,(H2,28,37)/t12-,14+,19?,21?,27+/m1/s1 |
| InChIKey | UJZMRGWBRPKDTF-ASVQHLDYSA-N |
| XLogP | -0.57 |
| TPSA | 193.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|