C25H26N2O8 — CID 90872887
(4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(3-oxobut-1-enyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90872887) has the molecular formula C25H26N2O8 and a molecular weight of 482.49 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(3-oxobut-1-enyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(3-oxobut-1-enyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90872887 |
| Molecular Formula | C25H26N2O8 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(3-oxobut-1-enyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(=O)C=Cc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C25H26N2O8/c1-10(28)4-5-11-8-15(27(2)3)14-7-12-6-13-9-16(29)19(24(26)34)23(33)25(13,35)22(32)17(12)21(31)18(14)20(11)30/h4-5,8,12-13,17,19,30,35H,6-7,9H2,1-3H3,(H2,26,34)/t12-,13+,17?,19?,25+/m1/s1 |
| InChIKey | PXUADUVSWGOEJA-HOJFSAQUSA-N |
| XLogP | -0.00 |
| TPSA | 172.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|