C32H38N4O8 — CID 91571522
(2R,4S,4aS,5aR,12aS)-9-[(4-acetylphenyl)methylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 91571522) has the molecular formula C32H38N4O8 and a molecular weight of 606.68 g/mol. Its IUPAC name is (2R,4S,4aS,5aR,12aS)-9-[(4-acetylphenyl)methylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (2R,4S,4aS,5aR,12aS)-9-[(4-acetylphenyl)methylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91571522 |
| Molecular Formula | C32H38N4O8 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | (2R,4S,4aS,5aR,12aS)-9-[(4-acetylphenyl)methylamino]-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CC(=O)c1ccc(CNc2cc(N(C)C)c3c(c2O)C(=O)C2C(=O)[C@]4(O)C(=O)[C@H](C(N)=O)C(O)[C@@H](N(C)C)[C@@H]4C[C@@H]2C3)cc1 |
| InChI | InChI=1S/C32H38N4O8/c1-14(37)16-8-6-15(7-9-16)13-34-20-12-21(35(2)3)18-10-17-11-19-25(36(4)5)28(40)24(31(33)43)30(42)32(19,44)29(41)22(17)27(39)23(18)26(20)38/h6-9,12,17,19,22,24-25,28,34,38,40,44H,10-11,13H2,1-5H3,(H2,33,43)/t17-,19-,22?,24+,25-,28?,32-/m0/s1 |
| InChIKey | IEMIVSGKGUERNW-YXURNTBSSA-N |
| XLogP | 0.54 |
| TPSA | 190.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|