C28H39N3O7 — CID 90942731
(4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-9-pentyl-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 90942731) has the molecular formula C28H39N3O7 and a molecular weight of 529.63 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-9-pentyl-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-9-pentyl-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90942731 |
| Molecular Formula | C28H39N3O7 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-9-pentyl-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CCCCCc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@@]3(O)C(=O)C(C(N)=O)C(O)[C@H](N(C)C)[C@H]3C[C@H]1C2 |
| InChI | InChI=1S/C28H39N3O7/c1-6-7-8-9-13-12-17(30(2)3)15-10-14-11-16-21(31(4)5)24(34)20(27(29)37)26(36)28(16,38)25(35)18(14)23(33)19(15)22(13)32/h12,14,16,18,20-21,24,32,34,38H,6-11H2,1-5H3,(H2,29,37)/t14-,16-,18?,20?,21-,24?,28-/m1/s1 |
| InChIKey | XOXFUIMMSBHNSU-DYERICJZSA-N |
| XLogP | 0.46 |
| TPSA | 161.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|