C29H40N4O8 — CID 90990388
(4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-9-[(3-methylbutanoylamino)methyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 90990388) has the molecular formula C29H40N4O8 and a molecular weight of 572.66 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-9-[(3-methylbutanoylamino)methyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-9-[(3-methylbutanoylamino)methyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90990388 |
| Molecular Formula | C29H40N4O8 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-3,10,12a-trihydroxy-9-[(3-methylbutanoylamino)methyl]-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CC(C)CC(=O)NCc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@@]3(O)C(=O)C(C(N)=O)C(O)[C@H](N(C)C)[C@H]3C[C@H]1C2 |
| InChI | InChI=1S/C29H40N4O8/c1-12(2)7-18(34)31-11-14-10-17(32(3)4)15-8-13-9-16-22(33(5)6)25(37)21(28(30)40)27(39)29(16,41)26(38)19(13)24(36)20(15)23(14)35/h10,12-13,16,19,21-22,25,35,37,41H,7-9,11H2,1-6H3,(H2,30,40)(H,31,34)/t13-,16-,19?,21?,22-,25?,29-/m1/s1 |
| InChIKey | WOWCTKJYQSFVEY-HFYWBBFHSA-N |
| XLogP | -0.61 |
| TPSA | 190.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|