C31H34F2N4O8 — CID 54681115
9-[[4-(difluoromethoxy)phenyl]methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54681115) has the molecular formula C31H34F2N4O8 and a molecular weight of 628.63 g/mol. Its IUPAC name is 9-[[4-(difluoromethoxy)phenyl]methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-[[4-(difluoromethoxy)phenyl]methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54681115 |
| Molecular Formula | C31H34F2N4O8 |
| Molecular Weight | 628.63 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | 9-[[4-(difluoromethoxy)phenyl]methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NCc2ccc(OC(F)F)cc2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C31H34F2N4O8/c1-36(2)19-11-18(35-12-13-5-7-15(8-6-13)45-30(32)33)24(38)21-16(19)9-14-10-17-23(37(3)4)26(40)22(29(34)43)28(42)31(17,44)27(41)20(14)25(21)39/h5-8,11,14,17,23,30,35,38-39,42,44H,9-10,12H2,1-4H3,(H2,34,43) |
| InChIKey | UQXTVMXKJMGLQF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 185.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.63 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|