C25H32N4O9S — CID 69200472
(4S,12aR)-4,7-bis(dimethylamino)-9-(ethylsulfonylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 69200472) has the molecular formula C25H32N4O9S and a molecular weight of 564.62 g/mol. Its IUPAC name is (4S,12aR)-4,7-bis(dimethylamino)-9-(ethylsulfonylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4,7-bis(dimethylamino)-9-(ethylsulfonylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 69200472 |
| Molecular Formula | C25H32N4O9S |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | (4S,12aR)-4,7-bis(dimethylamino)-9-(ethylsulfonylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCS(=O)(=O)Nc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3CC1C2 |
| InChI | InChI=1S/C25H32N4O9S/c1-6-39(37,38)27-13-9-14(28(2)3)11-7-10-8-12-18(29(4)5)21(32)17(24(26)35)23(34)25(12,36)22(33)15(10)20(31)16(11)19(13)30/h9-10,12,18,27,30-31,34,36H,6-8H2,1-5H3,(H2,26,35)/t10?,12?,18-,25-/m0/s1 |
| InChIKey | MFVAXPMCQLVAAU-HSYBOCGBSA-N |
| XLogP | -0.21 |
| TPSA | 210.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|