C30H32F2N4O7 — CID 137475593
(4S,4aR,5aR)-9-[(3,5-difluorophenyl)methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 137475593) has the molecular formula C30H32F2N4O7 and a molecular weight of 598.60 g/mol. Its IUPAC name is (4S,4aR,5aR)-9-[(3,5-difluorophenyl)methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5aR)-9-[(3,5-difluorophenyl)methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137475593 |
| Molecular Formula | C30H32F2N4O7 |
| Molecular Weight | 598.60 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | (4S,4aR,5aR)-9-[(3,5-difluorophenyl)methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NCc2cc(F)cc(F)c2)c(O)c2c1C[C@H]1C[C@@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H32F2N4O7/c1-35(2)19-10-18(34-11-12-5-14(31)9-15(32)6-12)24(37)21-16(19)7-13-8-17-23(36(3)4)26(39)22(29(33)42)28(41)30(17,43)27(40)20(13)25(21)38/h5-6,9-10,13,17,23,34,37-38,41,43H,7-8,11H2,1-4H3,(H2,33,42)/t13-,17+,23-,30?/m0/s1 |
| InChIKey | XQIAHUQWVNFIKX-YJSPVRLMSA-N |
| XLogP | 1.92 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.60 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|