C33H40N4O7 — CID 54719088
4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(4-propan-2-ylphenyl)methylamino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54719088) has the molecular formula C33H40N4O7 and a molecular weight of 604.70 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(4-propan-2-ylphenyl)methylamino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(4-propan-2-ylphenyl)methylamino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54719088 |
| Molecular Formula | C33H40N4O7 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(4-propan-2-ylphenyl)methylamino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)c1ccc(CNc2cc(N(C)C)c3c(c2O)C(O)=C2C(=O)C4(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C4CC2C3)cc1 |
| InChI | InChI=1S/C33H40N4O7/c1-15(2)17-9-7-16(8-10-17)14-35-21-13-22(36(3)4)19-11-18-12-20-26(37(5)6)29(40)25(32(34)43)31(42)33(20,44)30(41)23(18)28(39)24(19)27(21)38/h7-10,13,15,18,20,26,35,38-39,42,44H,11-12,14H2,1-6H3,(H2,34,43) |
| InChIKey | MQBQWDCUKWMRDP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|