C33H38N4O9 — CID 54741308
methyl 4-[[[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methylamino]methyl]benzoate (PubChem CID 54741308) has the molecular formula C33H38N4O9 and a molecular weight of 634.69 g/mol. Its IUPAC name is methyl 4-[[[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methylamino]methyl]benzoate.
| Compound Name | methyl 4-[[[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 54741308 |
| Molecular Formula | C33H38N4O9 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | methyl 4-[[[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNCc2cc(N(C)C)c3c(c2O)C(O)=C2C(=O)[C@]4(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]4C[C@@H]2C3)cc1 |
| InChI | InChI=1S/C33H38N4O9/c1-36(2)21-12-18(14-35-13-15-6-8-16(9-7-15)32(44)46-5)26(38)23-19(21)10-17-11-20-25(37(3)4)28(40)24(31(34)43)30(42)33(20,45)29(41)22(17)27(23)39/h6-9,12,17,20,25,35,38-39,42,45H,10-11,13-14H2,1-5H3,(H2,34,43)/t17-,20-,25-,33-/m0/s1 |
| InChIKey | AFHLUFIHPFRPNH-OJKYVGMKSA-N |
| XLogP | 1.11 |
| TPSA | 202.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|