C29H40N4O7 — CID 137475645
(4S,4aR,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(2-methylbutylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 137475645) has the molecular formula C29H40N4O7 and a molecular weight of 556.66 g/mol. Its IUPAC name is (4S,4aR,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(2-methylbutylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(2-methylbutylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137475645 |
| Molecular Formula | C29H40N4O7 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | (4S,4aR,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(2-methylbutylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCC(C)CNCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C29H40N4O7/c1-7-13(2)11-31-12-15-10-18(32(3)4)16-8-14-9-17-22(33(5)6)25(36)21(28(30)39)27(38)29(17,40)26(37)19(14)24(35)20(16)23(15)34/h10,13-14,17,22,31,34-35,38,40H,7-9,11-12H2,1-6H3,(H2,30,39)/t13?,14-,17+,22-,29-/m0/s1 |
| InChIKey | DAQGHHRDZMLTCT-HOVWRRERSA-N |
| XLogP | 1.17 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|