C28H38N4O9 — CID 59653998
(4S,4aS,5aR,12aR)-9-[(2,2-dimethoxyethylamino)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 59653998) has the molecular formula C28H38N4O9 and a molecular weight of 574.63 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-[(2,2-dimethoxyethylamino)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-[(2,2-dimethoxyethylamino)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59653998 |
| Molecular Formula | C28H38N4O9 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-[(2,2-dimethoxyethylamino)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COC(CNCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2)OC |
| InChI | InChI=1S/C28H38N4O9/c1-31(2)16-9-13(10-30-11-17(40-5)41-6)22(33)19-14(16)7-12-8-15-21(32(3)4)24(35)20(27(29)38)26(37)28(15,39)25(36)18(12)23(19)34/h9,12,15,17,21,30,33-34,37,39H,7-8,10-11H2,1-6H3,(H2,29,38)/t12-,15-,21-,28-/m0/s1 |
| InChIKey | JPSAQRKFMMLAHH-RBMSIWGPSA-N |
| XLogP | -0.26 |
| TPSA | 195.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|