C32H37ClN4O9 — CID 69200505
(4S)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-phenylmethoxyacetyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride (PubChem CID 69200505) has the molecular formula C32H37ClN4O9 and a molecular weight of 657.12 g/mol. Its IUPAC name is (4S)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-phenylmethoxyacetyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride.
| Compound Name | (4S)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-phenylmethoxyacetyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 69200505 |
| Molecular Formula | C32H37ClN4O9 |
| Molecular Weight | 657.12 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | (4S)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-phenylmethoxyacetyl)amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
| SMILES | CN(C)c1cc(NC(=O)COCc2ccccc2)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O.Cl |
| InChI | InChI=1S/C32H36N4O9.ClH/c1-35(2)20-12-19(34-21(37)14-45-13-15-8-6-5-7-9-15)26(38)23-17(20)10-16-11-18-25(36(3)4)28(40)24(31(33)43)30(42)32(18,44)29(41)22(16)27(23)39;/h5-9,12,16,18,25,38-39,42,44H,10-11,13-14H2,1-4H3,(H2,33,43)(H,34,37);1H/t16?,18?,25-,32?;/m0./s1 |
| InChIKey | YXRZFQPBAYANAT-PVFRUMIDSA-N |
| XLogP | 1.61 |
| TPSA | 202.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.12 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|