C34H39N5O8 — CID 71025030
N-[(6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-benzylazetidine-3-carboxamide (PubChem CID 71025030) has the molecular formula C34H39N5O8 and a molecular weight of 645.71 g/mol. Its IUPAC name is N-[(6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-benzylazetidine-3-carboxamide.
| Compound Name | N-[(6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-benzylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 71025030 |
| Molecular Formula | C34H39N5O8 |
| Molecular Weight | 645.71 g/mol |
| Exact Mass | 645.28 |
| IUPAC Name | N-[(6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-benzylazetidine-3-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)C2CN(Cc3ccccc3)C2)c(O)c2c1CC1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C34H39N5O8/c1-37(2)22-12-21(36-33(46)18-14-39(15-18)13-16-8-6-5-7-9-16)27(40)24-19(22)10-17-11-20-26(38(3)4)29(42)25(32(35)45)31(44)34(20,47)30(43)23(17)28(24)41/h5-9,12,17-18,20,26,40-41,44,47H,10-11,13-15H2,1-4H3,(H2,35,45)(H,36,46)/t17?,20-,26-,34-/m0/s1 |
| InChIKey | UEFNGSXLRFAYIH-ZXZNDWAQSA-N |
| XLogP | 1.10 |
| TPSA | 196.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.71 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|