C31H35N5O9 — CID 58461322
(4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(4-methoxyphenyl)carbamoylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58461322) has the molecular formula C31H35N5O9 and a molecular weight of 621.65 g/mol. Its IUPAC name is (4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(4-methoxyphenyl)carbamoylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(4-methoxyphenyl)carbamoylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58461322 |
| Molecular Formula | C31H35N5O9 |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | (4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(4-methoxyphenyl)carbamoylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)Nc2cc(N(C)C)c3c(c2O)C(O)=C2C(=O)[C@@]4(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)[C@H]4C[C@H]2C3)cc1 |
| InChI | InChI=1S/C31H35N5O9/c1-35(2)19-12-18(34-30(43)33-14-6-8-15(45-5)9-7-14)24(37)21-16(19)10-13-11-17-23(36(3)4)26(39)22(29(32)42)28(41)31(17,44)27(40)20(13)25(21)38/h6-9,12-13,17,23,37-38,41,44H,10-11H2,1-5H3,(H2,32,42)(H2,33,34,43)/t13-,17-,23?,31-/m1/s1 |
| InChIKey | AXWADBMIKOPJLU-IMKKISTJSA-N |
| XLogP | 1.68 |
| TPSA | 214.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|