C27H32N4O9 — CID 54684353
prop-2-enyl N-[(7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamate (PubChem CID 54684353) has the molecular formula C27H32N4O9 and a molecular weight of 556.57 g/mol. Its IUPAC name is prop-2-enyl N-[(7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamate.
| Compound Name | prop-2-enyl N-[(7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamate |
|---|---|
| PubChem CID | 54684353 |
| Molecular Formula | C27H32N4O9 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | prop-2-enyl N-[(7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamate |
| SMILES | C=CCOC(=O)Nc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3CC1C2 |
| InChI | InChI=1S/C27H32N4O9/c1-6-7-40-26(38)29-14-10-15(30(2)3)12-8-11-9-13-19(31(4)5)22(34)18(25(28)37)24(36)27(13,39)23(35)16(11)21(33)17(12)20(14)32/h6,10-11,13,19,32-33,36,39H,1,7-9H2,2-5H3,(H2,28,37)(H,29,38)/t11?,13?,19-,27-/m0/s1 |
| InChIKey | OINZDTDDAKBRDF-WAGSUCQCSA-N |
| XLogP | 0.76 |
| TPSA | 202.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|