C34H38N4O11 — CID 54683208
[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamoyloxymethyl 3,5-dimethylbenzoate (PubChem CID 54683208) has the molecular formula C34H38N4O11 and a molecular weight of 678.70 g/mol. Its IUPAC name is [(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamoyloxymethyl 3,5-dimethylbenzoate.
| Compound Name | [(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamoyloxymethyl 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 54683208 |
| Molecular Formula | C34H38N4O11 |
| Molecular Weight | 678.70 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | [(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamoyloxymethyl 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCOC(=O)Nc2cc(N(C)C)c3c(c2O)C(O)=C2C(=O)[C@]4(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]4C[C@@H]2C3)c1 |
| InChI | InChI=1S/C34H38N4O11/c1-14-7-15(2)9-17(8-14)32(45)48-13-49-33(46)36-20-12-21(37(3)4)18-10-16-11-19-25(38(5)6)28(41)24(31(35)44)30(43)34(19,47)29(42)22(16)27(40)23(18)26(20)39/h7-9,12,16,19,25,39-40,43,47H,10-11,13H2,1-6H3,(H2,35,44)(H,36,46)/t16-,19-,25-,34-/m0/s1 |
| InChIKey | ZBXAKCJXZMHRNG-CXBCMVSCSA-N |
| XLogP | 2.01 |
| TPSA | 229.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.70 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|