C33H35N5O8S — CID 54708568
(4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54708568) has the molecular formula C33H35N5O8S and a molecular weight of 661.74 g/mol. Its IUPAC name is (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54708568 |
| Molecular Formula | C33H35N5O8S |
| Molecular Weight | 661.74 g/mol |
| Exact Mass | 661.22 |
| IUPAC Name | (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1ccc(-c2cnc(Nc3cc(N(C)C)c4c(c3O)C(O)=C3C(=O)[C@]5(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C5CC3C4)s2)cc1 |
| InChI | InChI=1S/C33H35N5O8S/c1-37(2)20-12-19(36-32-35-13-21(47-32)14-6-8-16(46-5)9-7-14)26(39)23-17(20)10-15-11-18-25(38(3)4)28(41)24(31(34)44)30(43)33(18,45)29(42)22(15)27(23)40/h6-9,12-13,15,18,25,39-40,43,45H,10-11H2,1-5H3,(H2,34,44)(H,35,36)/t15?,18?,25-,33-/m0/s1 |
| InChIKey | RTQJFQXFRXNVQC-CTFVCTIKSA-N |
| XLogP | 2.91 |
| TPSA | 198.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.74 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|