C30H35N5O12S — CID 69200097
(4S,12aR)-9-[(4-aminobenzoyl)amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid (PubChem CID 69200097) has the molecular formula C30H35N5O12S and a molecular weight of 689.70 g/mol. Its IUPAC name is (4S,12aR)-9-[(4-aminobenzoyl)amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid.
| Compound Name | (4S,12aR)-9-[(4-aminobenzoyl)amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 69200097 |
| Molecular Formula | C30H35N5O12S |
| Molecular Weight | 689.70 g/mol |
| Exact Mass | 689.20 |
| IUPAC Name | (4S,12aR)-9-[(4-aminobenzoyl)amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
| SMILES | CN(C)c1cc(NC(=O)c2ccc(N)cc2)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O.O=S(=O)(O)O |
| InChI | InChI=1S/C30H33N5O8.H2O4S/c1-34(2)18-11-17(33-29(42)12-5-7-14(31)8-6-12)23(36)20-15(18)9-13-10-16-22(35(3)4)25(38)21(28(32)41)27(40)30(16,43)26(39)19(13)24(20)37;1-5(2,3)4/h5-8,11,13,16,22,36-37,40,43H,9-10,31H2,1-4H3,(H2,32,41)(H,33,42);(H2,1,2,3,4)/t13?,16?,22-,30-;/m0./s1 |
| InChIKey | QKCBETCDRHOGTF-DDEOAFAGSA-N |
| XLogP | 0.21 |
| TPSA | 294.35 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.70 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|