C31H31F3N4O8 — CID 69201798
(4S)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[3-(trifluoromethyl)benzoyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 69201798) has the molecular formula C31H31F3N4O8 and a molecular weight of 644.60 g/mol. Its IUPAC name is (4S)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[3-(trifluoromethyl)benzoyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[3-(trifluoromethyl)benzoyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 69201798 |
| Molecular Formula | C31H31F3N4O8 |
| Molecular Weight | 644.60 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | (4S)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[[3-(trifluoromethyl)benzoyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)c2cccc(C(F)(F)F)c2)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C31H31F3N4O8/c1-37(2)18-11-17(36-29(45)12-6-5-7-14(8-12)31(32,33)34)23(39)20-15(18)9-13-10-16-22(38(3)4)25(41)21(28(35)44)27(43)30(16,46)26(42)19(13)24(20)40/h5-8,11,13,16,22,39-40,43,46H,9-10H2,1-4H3,(H2,35,44)(H,36,45)/t13?,16?,22-,30?/m0/s1 |
| InChIKey | MCSLQBKBQGOAET-ZLACPXTRSA-N |
| XLogP | 2.30 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.60 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|