C23H24INO7 — CID 91550677
(4aS,5aR,12aS)-9-tert-butyl-10,12a-dihydroxy-7-iodo-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91550677) has the molecular formula C23H24INO7 and a molecular weight of 553.35 g/mol. Its IUPAC name is (4aS,5aR,12aS)-9-tert-butyl-10,12a-dihydroxy-7-iodo-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-9-tert-butyl-10,12a-dihydroxy-7-iodo-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91550677 |
| Molecular Formula | C23H24INO7 |
| Molecular Weight | 553.35 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | (4aS,5aR,12aS)-9-tert-butyl-10,12a-dihydroxy-7-iodo-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)(C)c1cc(I)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C23H24INO7/c1-22(2,3)11-7-12(24)10-5-8-4-9-6-13(26)16(21(25)31)20(30)23(9,32)19(29)14(8)18(28)15(10)17(11)27/h7-9,14,16,27,32H,4-6H2,1-3H3,(H2,25,31)/t8-,9+,14?,16?,23+/m1/s1 |
| InChIKey | UEEBEZBZXSWLEO-URJJDGCVSA-N |
| XLogP | 1.23 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|