C23H23NO8 — CID 91351701
(4aS,5aR,12aS)-9-formyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91351701) has the molecular formula C23H23NO8 and a molecular weight of 441.44 g/mol. Its IUPAC name is (4aS,5aR,12aS)-9-formyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-9-formyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91351701 |
| Molecular Formula | C23H23NO8 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (4aS,5aR,12aS)-9-formyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-propan-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)c1cc(C=O)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C23H23NO8/c1-8(2)12-5-10(7-25)18(27)16-13(12)4-9-3-11-6-14(26)17(22(24)31)21(30)23(11,32)20(29)15(9)19(16)28/h5,7-9,11,15,17,27,32H,3-4,6H2,1-2H3,(H2,24,31)/t9-,11+,15?,17?,23+/m1/s1 |
| InChIKey | DDJWQNCFYGVFSM-KILGOPOHSA-N |
| XLogP | 0.26 |
| TPSA | 168.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|