C27H30N2O9 — CID 91127860
but-3-enyl N-[(5aR,6aS,10aS)-9-carbamoyl-1,10a-dihydroxy-8,10,11,12-tetraoxo-4-propan-2-yl-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamate (PubChem CID 91127860) has the molecular formula C27H30N2O9 and a molecular weight of 526.54 g/mol. Its IUPAC name is but-3-enyl N-[(5aR,6aS,10aS)-9-carbamoyl-1,10a-dihydroxy-8,10,11,12-tetraoxo-4-propan-2-yl-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamate.
| Compound Name | but-3-enyl N-[(5aR,6aS,10aS)-9-carbamoyl-1,10a-dihydroxy-8,10,11,12-tetraoxo-4-propan-2-yl-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamate |
|---|---|
| PubChem CID | 91127860 |
| Molecular Formula | C27H30N2O9 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | but-3-enyl N-[(5aR,6aS,10aS)-9-carbamoyl-1,10a-dihydroxy-8,10,11,12-tetraoxo-4-propan-2-yl-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]carbamate |
| SMILES | C=CCCOC(=O)Nc1cc(C(C)C)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C27H30N2O9/c1-4-5-6-38-26(36)29-16-10-14(11(2)3)15-8-12-7-13-9-17(30)20(25(28)35)24(34)27(13,37)23(33)18(12)22(32)19(15)21(16)31/h4,10-13,18,20,31,37H,1,5-9H2,2-3H3,(H2,28,35)(H,29,36)/t12-,13+,18?,20?,27+/m1/s1 |
| InChIKey | ZIYCVPHXRIHARR-VLJOVHOGSA-N |
| XLogP | 1.57 |
| TPSA | 190.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|