C28H29N3O8 — CID 123687171
(12aS)-10,12a-dihydroxy-9-[[(4-hydroxyphenyl)methylamino]methyl]-7-(methylamino)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123687171) has the molecular formula C28H29N3O8 and a molecular weight of 535.55 g/mol. Its IUPAC name is (12aS)-10,12a-dihydroxy-9-[[(4-hydroxyphenyl)methylamino]methyl]-7-(methylamino)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (12aS)-10,12a-dihydroxy-9-[[(4-hydroxyphenyl)methylamino]methyl]-7-(methylamino)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123687171 |
| Molecular Formula | C28H29N3O8 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | (12aS)-10,12a-dihydroxy-9-[[(4-hydroxyphenyl)methylamino]methyl]-7-(methylamino)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CNc1cc(CNCc2ccc(O)cc2)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C28H29N3O8/c1-30-18-8-14(11-31-10-12-2-4-16(32)5-3-12)23(34)21-17(18)7-13-6-15-9-19(33)22(27(29)38)26(37)28(15,39)25(36)20(13)24(21)35/h2-5,8,13,15,20,22,30-32,34,39H,6-7,9-11H2,1H3,(H2,29,38)/t13?,15?,20?,22?,28-/m0/s1 |
| InChIKey | LXMWHIZYOOUJDQ-FVWZJMSNSA-N |
| XLogP | 0.36 |
| TPSA | 196.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|