C22H23NO9S — CID 123683794
(4aS,5aR,12aS)-10,12a-dihydroxy-7-methyl-9-(methylsulfonylmethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123683794) has the molecular formula C22H23NO9S and a molecular weight of 477.49 g/mol. Its IUPAC name is (4aS,5aR,12aS)-10,12a-dihydroxy-7-methyl-9-(methylsulfonylmethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-10,12a-dihydroxy-7-methyl-9-(methylsulfonylmethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123683794 |
| Molecular Formula | C22H23NO9S |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | (4aS,5aR,12aS)-10,12a-dihydroxy-7-methyl-9-(methylsulfonylmethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | Cc1cc(CS(C)(=O)=O)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C22H23NO9S/c1-8-3-10(7-33(2,31)32)17(25)15-12(8)5-9-4-11-6-13(24)16(21(23)29)20(28)22(11,30)19(27)14(9)18(15)26/h3,9,11,14,16,25,30H,4-7H2,1-2H3,(H2,23,29)/t9-,11+,14?,16?,22+/m1/s1 |
| InChIKey | ZNVZDYNZENUGMV-WPLOKDTPSA-N |
| XLogP | -0.82 |
| TPSA | 185.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|