C31H29N3O8 — CID 54692031
7-[2-(4-acetamidophenyl)ethynyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54692031) has the molecular formula C31H29N3O8 and a molecular weight of 571.59 g/mol. Its IUPAC name is 7-[2-(4-acetamidophenyl)ethynyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-[2-(4-acetamidophenyl)ethynyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54692031 |
| Molecular Formula | C31H29N3O8 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 7-[2-(4-acetamidophenyl)ethynyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C#Cc2ccc(O)c3c2CC2CC4C(N(C)C)C(=O)C(C(N)=O)=C(O)C4(O)C(=O)C2=C3O)cc1 |
| InChI | InChI=1S/C31H29N3O8/c1-14(35)33-18-9-5-15(6-10-18)4-7-16-8-11-21(36)23-19(16)12-17-13-20-25(34(2)3)27(38)24(30(32)41)29(40)31(20,42)28(39)22(17)26(23)37/h5-6,8-11,17,20,25,36-37,40,42H,12-13H2,1-3H3,(H2,32,41)(H,33,35) |
| InChIKey | YPKBBGUOGWDACQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|