C25H26N2O7 — CID 58461351
(4R,4aS,5aS,12aR)-7-but-1-ynyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58461351) has the molecular formula C25H26N2O7 and a molecular weight of 466.49 g/mol. Its IUPAC name is (4R,4aS,5aS,12aR)-7-but-1-ynyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aS,12aR)-7-but-1-ynyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58461351 |
| Molecular Formula | C25H26N2O7 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (4R,4aS,5aS,12aR)-7-but-1-ynyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCC#Cc1ccc(O)c2c1C[C@@H]1C[C@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H26N2O7/c1-4-5-6-11-7-8-15(28)17-13(11)9-12-10-14-19(27(2)3)21(30)18(24(26)33)23(32)25(14,34)22(31)16(12)20(17)29/h7-8,12,14,19,28-29,32,34H,4,9-10H2,1-3H3,(H2,26,33)/t12-,14+,19-,25+/m1/s1 |
| InChIKey | AFNRACKWMMAXJB-BEGSHWABSA-N |
| XLogP | 0.73 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|