C29H26N2O8 — CID 54691932
4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-(3-hydroxyphenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54691932) has the molecular formula C29H26N2O8 and a molecular weight of 530.53 g/mol. Its IUPAC name is 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-(3-hydroxyphenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-(3-hydroxyphenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54691932 |
| Molecular Formula | C29H26N2O8 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-(3-hydroxyphenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(C#Cc5cccc(O)c5)c4CC3CC12 |
| InChI | InChI=1S/C29H26N2O8/c1-31(2)23-18-12-15-11-17-14(7-6-13-4-3-5-16(32)10-13)8-9-19(33)21(17)24(34)20(15)26(36)29(18,39)27(37)22(25(23)35)28(30)38/h3-5,8-10,15,18,23,32-34,37,39H,11-12H2,1-2H3,(H2,30,38) |
| InChIKey | DOKLEZQVGDQPEP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|