C31H30N2O7 — CID 59984309
(4R,4aR,5aS,12aS)-4-(dimethylamino)-7-[2-(3-ethylphenyl)ethynyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 59984309) has the molecular formula C31H30N2O7 and a molecular weight of 542.59 g/mol. Its IUPAC name is (4R,4aR,5aS,12aS)-4-(dimethylamino)-7-[2-(3-ethylphenyl)ethynyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aS)-4-(dimethylamino)-7-[2-(3-ethylphenyl)ethynyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59984309 |
| Molecular Formula | C31H30N2O7 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | (4R,4aR,5aS,12aS)-4-(dimethylamino)-7-[2-(3-ethylphenyl)ethynyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCc1cccc(C#Cc2ccc(O)c3c2C[C@@H]2C[C@@H]4[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@]4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C31H30N2O7/c1-4-15-6-5-7-16(12-15)8-9-17-10-11-21(34)23-19(17)13-18-14-20-25(33(2)3)27(36)24(30(32)39)29(38)31(20,40)28(37)22(18)26(23)35/h5-7,10-12,18,20,25,34-35,38,40H,4,13-14H2,1-3H3,(H2,32,39)/t18-,20-,25-,31-/m1/s1 |
| InChIKey | QGMJHMYIEUVLNY-SGJIDUICSA-N |
| XLogP | 1.93 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|