C30H28N2O8 — CID 54691934
4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-(3-methoxyphenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54691934) has the molecular formula C30H28N2O8 and a molecular weight of 544.56 g/mol. Its IUPAC name is 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-(3-methoxyphenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-(3-methoxyphenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54691934 |
| Molecular Formula | C30H28N2O8 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-(3-methoxyphenyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1cccc(C#Cc2ccc(O)c3c2CC2CC4C(N(C)C)C(=O)C(C(N)=O)=C(O)C4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C30H28N2O8/c1-32(2)24-19-13-16-12-18-15(8-7-14-5-4-6-17(11-14)40-3)9-10-20(33)22(18)25(34)21(16)27(36)30(19,39)28(37)23(26(24)35)29(31)38/h4-6,9-11,16,19,24,33-34,37,39H,12-13H2,1-3H3,(H2,31,38) |
| InChIKey | KOPRAJFQPRMVGZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|