C24H22N2O9 — CID 54691894
3-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-ynoic acid (PubChem CID 54691894) has the molecular formula C24H22N2O9 and a molecular weight of 482.45 g/mol. Its IUPAC name is 3-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-ynoic acid.
| Compound Name | 3-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-ynoic acid |
|---|---|
| PubChem CID | 54691894 |
| Molecular Formula | C24H22N2O9 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 3-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]prop-2-ynoic acid |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(C#CC(=O)O)c4CC3CC12 |
| InChI | InChI=1S/C24H22N2O9/c1-26(2)18-12-8-10-7-11-9(4-6-14(28)29)3-5-13(27)16(11)19(30)15(10)21(32)24(12,35)22(33)17(20(18)31)23(25)34/h3,5,10,12,18,27,30,33,35H,7-8H2,1-2H3,(H2,25,34)(H,28,29) |
| InChIKey | BZVGXOOCOVRBFR-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 198.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|