C29H29N3O8 — CID 54749644
(4S,4aS,5aR,12aR)-7-(3-acetamidophenyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54749644) has the molecular formula C29H29N3O8 and a molecular weight of 547.56 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-7-(3-acetamidophenyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-7-(3-acetamidophenyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54749644 |
| Molecular Formula | C29H29N3O8 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | (4S,4aS,5aR,12aR)-7-(3-acetamidophenyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(=O)Nc1cccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C29H29N3O8/c1-12(33)31-15-6-4-5-13(9-15)16-7-8-19(34)21-17(16)10-14-11-18-23(32(2)3)25(36)22(28(30)39)27(38)29(18,40)26(37)20(14)24(21)35/h4-9,14,18,23,34-35,38,40H,10-11H2,1-3H3,(H2,30,39)(H,31,33)/t14-,18-,23-,29-/m0/s1 |
| InChIKey | KPLARSIYGYZCNM-HPMLRQDSSA-N |
| XLogP | 1.59 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|