C31H31N3O8 — CID 137476258
(4R,4aS,5aS,12aR)-7-[4-(cyclopropanecarbonylamino)phenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 137476258) has the molecular formula C31H31N3O8 and a molecular weight of 573.60 g/mol. Its IUPAC name is (4R,4aS,5aS,12aR)-7-[4-(cyclopropanecarbonylamino)phenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aS,12aR)-7-[4-(cyclopropanecarbonylamino)phenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137476258 |
| Molecular Formula | C31H31N3O8 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | (4R,4aS,5aS,12aR)-7-[4-(cyclopropanecarbonylamino)phenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(NC(=O)C6CC6)cc5)c4C[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C31H31N3O8/c1-34(2)24-19-12-15-11-18-17(13-5-7-16(8-6-13)33-30(41)14-3-4-14)9-10-20(35)22(18)25(36)21(15)27(38)31(19,42)28(39)23(26(24)37)29(32)40/h5-10,14-15,19,24,35-36,39,42H,3-4,11-12H2,1-2H3,(H2,32,40)(H,33,41)/t15-,19+,24-,31+/m1/s1 |
| InChIKey | RYUKCWSQGGBOKR-OGOKMPTRSA-N |
| XLogP | 1.98 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|