C33H37N3O8 — CID 58461141
(4aR,5aS,12aS)-4-(dimethylamino)-7-[4-[4-(dimethylamino)butanoyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58461141) has the molecular formula C33H37N3O8 and a molecular weight of 603.67 g/mol. Its IUPAC name is (4aR,5aS,12aS)-4-(dimethylamino)-7-[4-[4-(dimethylamino)butanoyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aS)-4-(dimethylamino)-7-[4-[4-(dimethylamino)butanoyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58461141 |
| Molecular Formula | C33H37N3O8 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | (4aR,5aS,12aS)-4-(dimethylamino)-7-[4-[4-(dimethylamino)butanoyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)CCCC(=O)c1ccc(-c2ccc(O)c3c2C[C@@H]2C[C@@H]4C(N(C)C)C(=O)C(C(N)=O)=C(O)[C@]4(O)C(=O)C2=C3O)cc1 |
| InChI | InChI=1S/C33H37N3O8/c1-35(2)13-5-6-22(37)17-9-7-16(8-10-17)19-11-12-23(38)25-20(19)14-18-15-21-27(36(3)4)29(40)26(32(34)43)31(42)33(21,44)30(41)24(18)28(25)39/h7-12,18,21,27,38-39,42,44H,5-6,13-15H2,1-4H3,(H2,34,43)/t18-,21-,27?,33-/m1/s1 |
| InChIKey | FROKOMCMDFYLJX-XZCQEDAQSA-N |
| XLogP | 2.16 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|