C33H38N4O8 — CID 118580052
(4aS,5aR,12aR)-4-(dimethylamino)-7-[3-[3-(dimethylamino)propylcarbamoyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 118580052) has the molecular formula C33H38N4O8 and a molecular weight of 618.69 g/mol. Its IUPAC name is (4aS,5aR,12aR)-4-(dimethylamino)-7-[3-[3-(dimethylamino)propylcarbamoyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-4-(dimethylamino)-7-[3-[3-(dimethylamino)propylcarbamoyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 118580052 |
| Molecular Formula | C33H38N4O8 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | (4aS,5aR,12aR)-4-(dimethylamino)-7-[3-[3-(dimethylamino)propylcarbamoyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4C(N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C33H38N4O8/c1-36(2)12-6-11-35-32(44)17-8-5-7-16(13-17)19-9-10-22(38)24-20(19)14-18-15-21-26(37(3)4)28(40)25(31(34)43)30(42)33(21,45)29(41)23(18)27(24)39/h5,7-10,13,18,21,26,38-39,42,45H,6,11-12,14-15H2,1-4H3,(H2,34,43)(H,35,44)/t18-,21-,26?,33-/m0/s1 |
| InChIKey | SYUGSIJPXDLTCQ-QZLZRLHPSA-N |
| XLogP | 1.31 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|