C31H34N4O7 — CID 67635689
(4S,4aS,5aR,12aS)-7-[3-(2-aminoethylcarbamoyl)phenyl]-4-(dimethylamino)-10,11,12a-trihydroxy-3-methyl-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67635689) has the molecular formula C31H34N4O7 and a molecular weight of 574.63 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-[3-(2-aminoethylcarbamoyl)phenyl]-4-(dimethylamino)-10,11,12a-trihydroxy-3-methyl-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-[3-(2-aminoethylcarbamoyl)phenyl]-4-(dimethylamino)-10,11,12a-trihydroxy-3-methyl-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67635689 |
| Molecular Formula | C31H34N4O7 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-[3-(2-aminoethylcarbamoyl)phenyl]-4-(dimethylamino)-10,11,12a-trihydroxy-3-methyl-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1=C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cccc(C(=O)NCCN)c5)c4C[C@H]3C[C@H]2[C@@H]1N(C)C |
| InChI | InChI=1S/C31H34N4O7/c1-14-22(29(33)40)27(38)31(42)20(25(14)35(2)3)13-17-12-19-18(7-8-21(36)24(19)26(37)23(17)28(31)39)15-5-4-6-16(11-15)30(41)34-10-9-32/h4-8,11,17,20,25,36-37,42H,9-10,12-13,32H2,1-3H3,(H2,33,40)(H,34,41)/t17-,20-,25+,31+/m0/s1 |
| InChIKey | LZTURLMVVOWCIW-KAFKRVNFSA-N |
| XLogP | 0.82 |
| TPSA | 196.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|