C34H38N4O9 — CID 59158005
(4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[3-(2-morpholin-4-ylethylcarbamoyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 59158005) has the molecular formula C34H38N4O9 and a molecular weight of 646.70 g/mol. Its IUPAC name is (4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[3-(2-morpholin-4-ylethylcarbamoyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[3-(2-morpholin-4-ylethylcarbamoyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59158005 |
| Molecular Formula | C34H38N4O9 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | (4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[3-(2-morpholin-4-ylethylcarbamoyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cccc(C(=O)NCCN6CCOCC6)c5)c4CC3CC12 |
| InChI | InChI=1S/C34H38N4O9/c1-37(2)27-22-16-19-15-21-20(17-4-3-5-18(14-17)33(45)36-8-9-38-10-12-47-13-11-38)6-7-23(39)25(21)28(40)24(19)30(42)34(22,46)31(43)26(29(27)41)32(35)44/h3-7,14,19,22,27,39-40,43,46H,8-13,15-16H2,1-2H3,(H2,35,44)(H,36,45)/t19?,22?,27-,34-/m0/s1 |
| InChIKey | TZBCEFDERJMHPL-WEINZEQVSA-N |
| XLogP | 0.69 |
| TPSA | 202.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|