C32H35N3O8 — CID 54686663
(4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[3-(morpholin-4-ylmethyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54686663) has the molecular formula C32H35N3O8 and a molecular weight of 589.65 g/mol. Its IUPAC name is (4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[3-(morpholin-4-ylmethyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[3-(morpholin-4-ylmethyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54686663 |
| Molecular Formula | C32H35N3O8 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | (4S,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[3-(morpholin-4-ylmethyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cccc(CN6CCOCC6)c5)c4CC3CC12 |
| InChI | InChI=1S/C32H35N3O8/c1-34(2)26-21-14-18-13-20-19(17-5-3-4-16(12-17)15-35-8-10-43-11-9-35)6-7-22(36)24(20)27(37)23(18)29(39)32(21,42)30(40)25(28(26)38)31(33)41/h3-7,12,18,21,26,36-37,40,42H,8-11,13-15H2,1-2H3,(H2,33,41)/t18?,21?,26-,32-/m0/s1 |
| InChIKey | DFAODUPTDRSHMA-GJRJFGBKSA-N |
| XLogP | 1.46 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|