C27H31N3O9 — CID 137476506
(4S,4aR,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-(2-morpholin-4-ylacetyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 137476506) has the molecular formula C27H31N3O9 and a molecular weight of 541.56 g/mol. Its IUPAC name is (4S,4aR,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-(2-morpholin-4-ylacetyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aR,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-(2-morpholin-4-ylacetyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137476506 |
| Molecular Formula | C27H31N3O9 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | (4S,4aR,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-(2-morpholin-4-ylacetyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C(=O)CN5CCOCC5)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C27H31N3O9/c1-29(2)21-15-10-12-9-14-13(17(32)11-30-5-7-39-8-6-30)3-4-16(31)19(14)22(33)18(12)24(35)27(15,38)25(36)20(23(21)34)26(28)37/h3-4,12,15,21,31,33,36,38H,5-11H2,1-2H3,(H2,28,37)/t12-,15-,21+,27+/m1/s1 |
| InChIKey | SFZVPMHJVIRPPD-APYBZMBDSA-N |
| XLogP | -0.52 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|