C24H23F3N2O7 — CID 54740522
(4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(3,3,3-trifluoroprop-1-en-2-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54740522) has the molecular formula C24H23F3N2O7 and a molecular weight of 508.45 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(3,3,3-trifluoroprop-1-en-2-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(3,3,3-trifluoroprop-1-en-2-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54740522 |
| Molecular Formula | C24H23F3N2O7 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(3,3,3-trifluoroprop-1-en-2-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C=C(c1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)C(F)(F)F |
| InChI | InChI=1S/C24H23F3N2O7/c1-8(24(25,26)27)10-4-5-13(30)15-11(10)6-9-7-12-17(29(2)3)19(32)16(22(28)35)21(34)23(12,36)20(33)14(9)18(15)31/h4-5,9,12,17,30-31,34,36H,1,6-7H2,2-3H3,(H2,28,35)/t9-,12-,17-,23-/m0/s1 |
| InChIKey | DJCAKNAYJLZPME-NOUYFSLNSA-N |
| XLogP | 1.54 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|