C25H26F3N3O8 — CID 54749671
(4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[2-(2,2,2-trifluoroethylamino)acetyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54749671) has the molecular formula C25H26F3N3O8 and a molecular weight of 553.49 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[2-(2,2,2-trifluoroethylamino)acetyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[2-(2,2,2-trifluoroethylamino)acetyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54749671 |
| Molecular Formula | C25H26F3N3O8 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[2-(2,2,2-trifluoroethylamino)acetyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C(=O)CNCC(F)(F)F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C25H26F3N3O8/c1-31(2)18-12-6-9-5-11-10(14(33)7-30-8-24(26,27)28)3-4-13(32)16(11)19(34)15(9)21(36)25(12,39)22(37)17(20(18)35)23(29)38/h3-4,9,12,18,30,32,34,37,39H,5-8H2,1-2H3,(H2,29,38)/t9-,12-,18-,25-/m0/s1 |
| InChIKey | MOICHJLMZHSDFX-VIQYSOCQSA-N |
| XLogP | 0.30 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|